Please wait a moment until all data is loaded. This message will disappear when all data is loaded.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
cis-zeatin + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
cis-zeatin + acceptor + H2O
?
cis-zeatin + electron acceptor
(2Z)-4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
cis-zeatin + oxidized 2,6-dichlorophenolindophenol
?
cis/trans-zeatin + FAD + H2O
adenine + ? + FADH2
cis/trans-zeatin riboside + FAD + H2O
adenine + ? + FADH2
-
-
-
ir
cytokinin + 2,3-dimethoxy-5-methyl-1,4-benzoquinone
? + reduced 2,3-dimethoxy-5-methyl-1,4-benzoquinone
-
-
-
?
cytokinin riboside + 2,3-dimethoxy-5-methyl-1,4-benzoquinone
? + reduced 2,3-dimethoxy-5-methyl-1,4-benzoquinone
-
-
-
?
dihydrozeatin + electron acceptor
?
-
-
-
-
?
isopentenyladenine + 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
isopentenyladenine 9-glucoside + 2,6-dichlorophenolindophenol
adenine 9-glucoside + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
isopentenyladenosine + 2,6-dichlorophenolindophenol
adenosine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
isopentenyladenosine + acceptor + H2O
? + reduced acceptor
isopentenyladenosine monophosphate + 2,6-dichlorophenolindophenol
adenosine monophosphate + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
kinetin + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
?
-
-
-
?
kinetin + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
low activity
-
-
?
kinetin + electron acceptor
2-furaldehyde + adenine + reduced electron acceptor
-
-
-
-
?
kinetin + FAD
2-furaldehyde + adenine + FADH2
-
-
-
-
?
kinetin riboside + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
?
-
-
-
?
m-topolin + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very low activity
-
-
?
N-benzyladenine + electron acceptor
benzaldehyde + adenine + reduced electron acceptor
-
-
-
-
?
N-methyl-isopentenyladenine + FAD
?
-
-
-
-
?
N6-(2-butynyl)adenine + 2,6-dichlorophenol indophenol
?
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenine + 1,4-naphthoquinone
?
-
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenine + 1,4-naphthoquinone
adenine + 3-methylbut-2-enal + reduced 1,4-naphthoquinone
-
-
-
?
N6-(2-isopentenyl)adenine + 2,2'-azino-bis-(3-ethylbenzothiazoline-6-sulfonic acid) radical + H2O
adenine + 3-methylbut-2-enal + ?
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-1,4-benzoquinone
adenine + 3-methylbut-2-enal + reduced 2,3-dimethoxy-5-methyl-1,4-benzoquinone
i.e. coenzyme Q0
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
adenine + 3-methylbut-2-enal + 2,3-dimethoxy-5-methyl-1,4-benzoquinol
-
4-nitrosoresorcinol-1-monomethyl ether serves as a weak electron acceptor of CKX
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenol indophenol
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
N6-(2-isopentenyl)adenine + 4-nitrosoresorcinol-1-monomethyl ether + H2O
adenine + 3-methylbut-2-enal + reduced 4-nitrosoresorcinol-1-monomethyl ether
-
4-nitrosoresorcinol-1-monomethyl ether serves as a weak electron acceptor of CKX
-
-
?
N6-(2-isopentenyl)adenine + acceptor + H2O
?
-
preferred substrate of isozyme AtCKX4
-
-
?
N6-(2-isopentenyl)adenine + caffeic acid
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + coenzyme Q1
adenine + 3-methylbut-2-enal + reduced coenzyme Q1
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2
?
N6-(2-isopentenyl)adenine + CuCl2 + H2O
adenine + 3-methylbut-2-enal + ?
N6-(2-isopentenyl)adenine + cytochrome c
adenine + 3-methylbut-2-enal + reduced cytochrome c
-
-
-
?
N6-(2-isopentenyl)adenine + daphnoretin
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + duroquinone
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine + electron acceptor
adenine + 3-methylbut-2-enal + reduced electron acceptor
-
-
-
-
?
N6-(2-isopentenyl)adenine + FAD
adenine + 3-methylbut-2-enal + FADH2
N6-(2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
ir
N6-(2-isopentenyl)adenine + hydroxamic acid 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-one + H2O
adenine + 3-methylbut-2-enal + reduced hydroxamic acid 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-one
-
CKX1 is able to use hydroxamic acid 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-one as a poor electron acceptor at neutral pH levels, but not in acidic pH levels
-
-
?
N6-(2-isopentenyl)adenine + o-coumaric acid
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + O2
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine + O2
adenine + 3-methylbut-2-enal + H2O2
oxidative degradation of cytokinins, slow reaction, low substrate specificity
-
-
?
N6-(2-isopentenyl)adenine + plantacyanine
adenine + 3-methylbut-2-enal + reduced plantacyanine
electron acceptor from spinach
-
-
?
N6-(2-isopentenyl)adenine + potassium ferricyanide
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine + rosmarinic acid
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + scopoletin
adenine + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine + spinach plantacyanine
adenine + 3-methylbut-2-enal + reduced spinach plantacyanine
-
-
-
r
N6-(2-isopentenyl)adenine + vitamin K1
adenine + 3-methylbut-2-enal + reduced vitamin K1
-
-
-
?
N6-(2-isopentenyl)adenine + vitamin K3
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine + vitamin K3
adenine + 3-methylbut-2-enal + reduced vitamin K3
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-glucoside + 3',5'-dimethoxy-4'-hydroxyacetophenone + H2O
adenine 9-beta-D-glucoside + 3-methylbut-2-enal + ?
i.e. iP9G, best substrate for isozyme AtCKX1 at pH 5.0, 3',5'-dimethoxy-4-hydroxyacetophenone is the best acceptor
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + 2,3,5-triphenyl-tetrazolium chloride + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + 3',5'-dimethoxy-4'-hydroxyacetophenone + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + ferricyanide + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ferrocyanide
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + ferricytochrome c + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ferrocytochrome c
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + NAD+ + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + O2 + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside + oxidized 2,6-dichlorophenolindophenol + H2O
adenine 9-beta-D-riboside + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-(2-isopentenyl)adenine 9-beta-D-riboside 5'-phosphate + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
adenine 9-beta-D-riboside 5'-phosphate + 3-methylbut-2-enal + ?
-
-
-
?
N6-(2-isopentenyl)adenine 9-glucoside + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine 9-riboside + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
N6-(2-isopentenyl)adenine 9-riboside-5'-monophosphate + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenose + 2,6-dichlorophenolindophenol
adenosine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
N6-(2-isopentenyl)adenosine + 2,6-dichlorophenol indophenol
?
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenosine + FAD
adenosine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(4-hydroxy-2-butynyl)adenine + 2,6-dichlorophenol indophenol
?
very effective electron acceptor
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,3-dimetoxy-5-methyl-1,4-benzoquinone + H2O
?
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
N6-(DELTA2-isopentenyl)adenine + 4-methylcatechol + H2O
adenine + 3-methylbut-2-enal + reduced 4-methylcatechol
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + acetosyringone + H2O
adenine + 3-methylbut-2-enal + reduced acetosyringone
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + CuCl2 + H2O
adenine + 3-methyl-2-butenal + CuCl + Cl-
-
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
N6-(DELTA2-isopentenyl)adenine + guaiacol + H2O
adenine + 3-methylbut-2-enal + reduced guaiacol
-
-
-
?
N6-(DELTA2-isopentenyl)adenine-9-beta-D-glucoside + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + 2,6-dichlorophenolindophenol + H2O
adenosine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
artificial electron acceptor
-
-
?
N6-(DELTA2-isopentenyl)adenosine + 4-methylcatechol + H2O
adenosine + 3-methylbut-2-enal + reduced 4-methylcatechol
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + acetosyringone + H2O
adenosine + 3-methylbut-2-enal + reduced acetosyringone
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O
adenosine + 3-methylbut-2-enal + FADH2
N6-(DELTA2-isopentenyl)adenosine + guaiacol + H2O
adenosine + 3-methylbut-2-enal + reduced guaiacol
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine-5'-monophosphate + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
N6-benzyladenine + electron acceptor
?
-
-
-
-
?
N6-benzyladenine + FAD + H2O
adenine + ? + FADH2
N6-dimethylallyladenine + 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
i.e. isopentenyladenine, reaction via an imine intermediate
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
N6-dimethylallyladenine + FAD + H2O2
adenine + 3-methylbut-2-enal + FADH2 + O2
-
i.e. isopentenyladenine
-
-
?
N6-dimethylallyladenosine + FAD + H2O
adenosine + 3-methylbut-2-enal + FADH2
i.e. isopentenyladenosine
-
-
ir
N6-hexyladenine + electron acceptor
hexanal + adenine + reduced electron acceptor
-
-
-
-
?
N6-isopentenyl-2-(2-hydroxyethylamino)-9-methyladenine + electron acceptor
3-methyl-2-butenal + 2-hydroxyethylamino-9-methyladenine + reduced electron acceptor
-
-
-
-
?
N6-isopentenyl-2-methylthioadenine + electron acceptor
3-methyl-2-butenal + 2-methylthioadenine + reduced electron acceptor
-
-
-
-
?
N6-isopentenyladenine + 2,3-dimethoxy-5-methyl-1,4-benzoquinone
?
-
-
-
?
N6-isopentenyladenine + 2,6-dichlorophenolindophenol
adenine + 3-methyl-2-butenal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-isopentenyladenine + CuCl2
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
N6-isopentenyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
N6-isopentenyladenine + oxidized 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enol + reduced 2,6-dichlorophenolindophenol
N6-isopentenyladenine 9-beta-D-glucoside + oxidized 2,6-dichlorophenolindophenol
adenine 9-beta-D-glucoside + 3-methylbut-2-enol + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-isopentenyladenine-9-beta-D-glucoside + 2,3-dimethoxy-5-methyl-1,4-benzoquinone
?
-
-
-
?
N6-isopentenyladenosine + 2,6-dichlorophenolindophenol
3-methylbut-2-enal + adenosine + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-isopentenyladenosine + electron acceptor
3-methylbut-2-enal + adenosine + reduced electron acceptor
N6-isopentenyladenosine + oxidized 2,6-dichlorophenolindophenol
adenosine + 3-methylbut-2-enol + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-methyl-isopentenyladenine + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very low activity
-
-
?
O-beta-D-glucosyl-trans-zeatin + oxidized 2,6-dichlorophenolindophenol
?
-
-
-
?
o-topolin + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very low activity
-
-
?
p-topolin + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very low activity
-
-
?
p-topolin + FAD
?
-
-
-
-
?
thidiazuron + electron acceptor
?
-
-
-
-
?
trans-zeatin + 2,3-dimethoxy-5-methyl-1,4-benzoquinone + H2O
?
-
-
-
?
trans-zeatin + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very effective substrate
-
-
?
trans-zeatin + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
cis-zeatin is utilized only by some tissue-specific forms but not by HvCKX2
-
-
?
trans-zeatin + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
trans-zeatin + acceptor + H2O
?
trans-zeatin + electron acceptor
(2E)-4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
trans-zeatin + FAD + H2O
? + FADH2
trans-zeatin + FAD + H2O
adenine + ? + FADH2
trans-zeatin + oxidized 2,6-dichlorophenolindophenol
?
trans-zeatin 9-glucoside + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
low activity
-
-
?
trans-zeatin 9-riboside + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
very effective substrate
-
-
?
trans-zeatin O-glucoside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
trans-zeatin riboside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
trans-zeatin riboside + 2,6-dichlorophenolindophenol + H2O
?
most favorable substrate
-
-
?
trans-zeatin riboside O-glucoside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
trans-zeatin ribotide + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
trans-zeatin-9-glucoside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
zeatin + 2,6-dichlorophenolindophenol
4-hydroxy-3-methylbut-2-enal + adenine + reduced 2,6-dichlorophenolindophenol
-
-
-
?
zeatin + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
zeatin + electron acceptor
4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
zeatin + FAD
? + FADH2
-
-
-
?
zeatin + FAD + H2O
adenine + 4-hydroxy-3-methylbut-2-enal + FADH2
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
zeatin riboside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
additional information
?
-
cis-zeatin + acceptor + H2O

?
-
-
-
-
?
cis-zeatin + acceptor + H2O
?
-
preferred substrate of isozyme ZmCKX10
-
-
?
cis-zeatin + electron acceptor

(2Z)-4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
cis-zeatin + electron acceptor
(2Z)-4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
cis-zeatin + oxidized 2,6-dichlorophenolindophenol

?
-
-
-
-
?
cis-zeatin + oxidized 2,6-dichlorophenolindophenol
?
-
-
-
?
cis/trans-zeatin + FAD + H2O

adenine + ? + FADH2
-
-
-
ir
cis/trans-zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
isopentenyladenine + 2,6-dichlorophenolindophenol

adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
isopentenyladenine + 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
isopentenyladenosine + acceptor + H2O

? + reduced acceptor
-
-
-
-
?
isopentenyladenosine + acceptor + H2O
? + reduced acceptor
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-p-benzoquinone

?
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenol indophenol

?
-
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenol indophenol
?
-
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenol indophenol
?
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenol indophenol
?
very effective electron acceptor
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol

adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O

adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
N6-(2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2

?
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2
?
-
low activity
-
-
?
N6-(2-isopentenyl)adenine + CuCl2
?
-
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2 + H2O

adenine + 3-methylbut-2-enal + ?
-
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2 + H2O
adenine + 3-methylbut-2-enal + ?
-
-
-
-
?
N6-(2-isopentenyl)adenine + CuCl2 + H2O
adenine + 3-methylbut-2-enal + ?
-
-
-
-
?
N6-(2-isopentenyl)adenine + FAD

adenine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(2-isopentenyl)adenine + FAD
adenine + 3-methylbut-2-enal + FADH2
the natural terminal electron acceptor probably is a p-quinone or a similar compound, high substrate specificity for N6-(2-isopentenyl)adenine
-
-
?
N6-(2-isopentenyl)adenine + FAD
adenine + 3-methylbut-2-enal + FADH2
-
formation of a binary enzyme-product complex between the cytokinin imine and the reduced enzyme. The binary complex of the reduced enzyme and imine product intermediate decays relatively slowly to form an unbound product, cytokinin imine, which accumulates in the reaction mixture
-
-
?
N6-(2-isopentenyl)adenine 9-riboside + 2,3-dimethoxy-5-methyl-p-benzoquinone

?
-
-
-
-
?
N6-(2-isopentenyl)adenine 9-riboside + 2,3-dimethoxy-5-methyl-p-benzoquinone
?
-
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O

?
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
?
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
?
preferred substrate
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O

adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
artificial electron acceptor
-
-
?
N6-(DELTA2-isopentenyl)adenine + 2,6-dichlorophenolindophenol + H2O
adenine + 3-methylbut-2-enal + reduced 2,6-dichlorophenolindophenol
artificial electron acceptor
-
-
?
N6-(DELTA2-isopentenyl)adenine + FAD + H2O

adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
ir
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
oxidative degradation of cytokinins
-
-
ir
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O

adenosine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O
adenosine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-benzyladenine + FAD + H2O

adenine + ? + FADH2
-
-
-
-
ir
N6-benzyladenine + FAD + H2O
adenine + ? + FADH2
substrate binding mechanism and structure, overview
-
-
ir
N6-dimethylallyladenine + acceptor + H2O

adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + FAD + H2O

adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
Phaseolus sp.
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
Phaseolus sp.
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
i.e. isopentenyladenine
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
?
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
i.e. isopentenyladenine
-
-
ir
N6-isopentenyladenine + electron acceptor

adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
FAD is cofactor
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
FAD is cofactor
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
?
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
FAD is cofactor
-
ir
N6-isopentenyladenine + FAD + H2O

adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
ir
N6-isopentenyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
oxidative degradation
-
-
ir
N6-isopentenyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
substrate binding mechanism and structure, overview
-
-
ir
N6-isopentenyladenine + oxidized 2,6-dichlorophenolindophenol

adenine + 3-methylbut-2-enol + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
N6-isopentenyladenine + oxidized 2,6-dichlorophenolindophenol
adenine + 3-methylbut-2-enol + reduced 2,6-dichlorophenolindophenol
-
-
-
?
N6-isopentenyladenosine + electron acceptor

3-methylbut-2-enal + adenosine + reduced electron acceptor
-
-
-
-
?
N6-isopentenyladenosine + electron acceptor
3-methylbut-2-enal + adenosine + reduced electron acceptor
-
-
-
-
?
N6-isopentenyladenosine + electron acceptor
3-methylbut-2-enal + adenosine + reduced electron acceptor
-
-
-
-
?
trans-zeatin + acceptor + H2O

?
-
-
-
-
?
trans-zeatin + acceptor + H2O
?
-
preferred substrate of isozymes AtCKX4 and AtCKX1
-
-
?
trans-zeatin + acceptor + H2O
?
-
-
-
-
?
trans-zeatin + acceptor + H2O
?
-
preferred substrate of isozymes ZmCKX1 and ZmCKX10
-
-
?
trans-zeatin + FAD + H2O

? + FADH2
-
-
-
-
ir
trans-zeatin + FAD + H2O
? + FADH2
substrate binding mechanism and structure, overview
-
-
ir
trans-zeatin + FAD + H2O

adenine + ? + FADH2
-
-
-
ir
trans-zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
trans-zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
?
trans-zeatin + oxidized 2,6-dichlorophenolindophenol

?
-
-
-
-
?
trans-zeatin + oxidized 2,6-dichlorophenolindophenol
?
-
-
-
?
zeatin + 2,6-dichlorophenolindophenol

? + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
zeatin + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
zeatin + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
zeatin + electron acceptor

4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
ir
zeatin + electron acceptor
4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
zeatin + electron acceptor
4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
zeatin + electron acceptor
4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
-
?
zeatin + FAD + H2O

adenine + ? + FADH2
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
Phaseolus sp.
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
Phaseolus sp.
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin riboside + 2,6-dichlorophenolindophenol

? + reduced 2,6-dichlorophenolindophenol
-
-
-
?
zeatin riboside + 2,6-dichlorophenolindophenol
? + reduced 2,6-dichlorophenolindophenol
-
-
-
-
?
additional information

?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
the free bases and their ribosides are the preferred substrates
-
-
?
additional information
?
-
-
the free bases and their ribosides are the preferred substrates
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, by controlling the cytokinin level enzyme controls proliferation and differentiation of plant cells
-
-
?
additional information
?
-
-
AtCKX2 prefers p-quinones and 2,6-dichlorophenol indophenol as electron acceptors, low reactivity with oxygen
-
-
?
additional information
?
-
-
no activity with dihydrozeatin
-
-
?
additional information
?
-
-
no activity with vitamin K1 as electron acceptor
-
-
?
additional information
?
-
-
acceptor and substrate specificity, overview. The enzyme catalyzes the irreversible cleavage of N6-side chains from cytokinins. CKXs also show low cytokinin oxidase activity, but molecular oxygen is a comparatively poor electron acceptor. Vacuolar AtCKX enzymes in certain conditions degrade N6-(2-isopentenyl)adenine di- and triphosphates two to 5times more effectively than its monophosphate
-
-
?
additional information
?
-
acceptor and substrate specificity, overview. The enzyme catalyzes the irreversible cleavage of N6-side chains from cytokinins. CKXs also show low cytokinin oxidase activity, but molecular oxygen is a comparatively poor electron acceptor. Vacuolar AtCKX enzymes in certain conditions degrade N6-(2-isopentenyl)adenine di- and triphosphates two to 5times more effectively than its monophosphate
-
-
?
additional information
?
-
acceptor and substrate specificity, overview. The enzyme catalyzes the irreversible cleavage of N6-side chains from cytokinins. CKXs also show low cytokinin oxidase activity, but molecular oxygen is a comparatively poor electron acceptor. Vacuolar AtCKX enzymes in certain conditions degrade N6-(2-isopentenyl)adenine di- and triphosphates two to 5times more effectively than its monophosphate
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
analysis of enzyme activity regulation
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes
-
-
?
additional information
?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
tissue and isozyme-specific substrate specificity
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity
-
-
?
additional information
?
-
-
tissue and isozyme-specific substrate specificity, recombinant HvCKX2 prefers cytokinin ribosides as substrates
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity, recombinant HvCKX2 prefers cytokinin ribosides as substrates
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity, recombinant HvCKX2 prefers cytokinin ribosides as substrates
-
-
?
additional information
?
-
tissue and isozyme-specific substrate specificity, recombinant HvCKX2 prefers cytokinin ribosides as substrates
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
endogenous cytokinin levels after induction with N6-benzylaminopurine, overview, apoplastic enzyme degradation pathway
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
cytokinins stimulate pigment formation and nitrogen fixation
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
reduced expression of OsCKX2 causes cytokinin accumulation in inflorescence meristems and increases the number of reproductive organs, resulting in enhanced grain yield
-
-
?
additional information
?
-
Phaseolus sp.
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
no activity with zeatin, zeatin riboside, or N6-(2-hydroxybenzyl)adenine
-
-
?
additional information
?
-
-
enzyme expression changes differently due to stress response in the 2 pea cultivars
-
-
?
additional information
?
-
-
involvement of cytokinin oxidase/dehydrogenase in regulation of cytokinin levels in leaves
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, results suggest that CKX is responsible for the changes in endogenous cytokinin pool in gibberellic acid-treated plants and most probably this enzyme represents an important link in gibberellic acid/cytokinin cross talk
-
-
?
additional information
?
-
-
effects of exogenously applied auxins on cytokinin levels in seedlings, overview, exogenously applied cytokinins increase the glycosylation level of endogenous cytokinins, overview
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes during infection, cytokinins are involved in pathogenesis
-
-
?
additional information
?
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
additional information
?
-
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
additional information
?
-
enzyme has a major role in control of cytokinin plant hormone levels
-
-
?
additional information
?
-
-
enzyme has a major role in control of cytokinin plant hormone levels
-
-
?
additional information
?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
specificity for electron acceptors, overview
-
-
?
additional information
?
-
-
specificity for electron acceptors, overview
-
-
?
additional information
?
-
substrate specificity with cytokinins, overiew
-
-
?
additional information
?
-
-
substrate specificity with cytokinins, overiew
-
-
?
additional information
?
-
the substrate binding site is located at amino acid residues 245-491
-
-
?
additional information
?
-
-
the substrate binding site is located at amino acid residues 245-491
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, important for the regulation of early development of the plant embryo
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, important for the regulation of early development of the plant embryo
-
-
?
additional information
?
-
-
laccase and peroxidase catalyze oxidative cleavage of hydroxamic acid 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-one (DIMBOA) to 4-nitrosoresorcinol-1-monomethyl ether (coniferron) which serves as a weak electron acceptor of CKX1. The oxidation of DIMBOA and coniferron generates transitional free radicals that are used by CKX1 as effective electron acceptors. hydroxamic acid 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-glucoside is not active as an electron acceptor for isozyme CKX1
-
-
?
additional information
?
-
adenosine, abscisic acid, gibberellic acid, and cis-zeatin riboside are no substrates, nor is the reduced dihydrozeatin. Aromatic cytokinins, kinetin and N6-benzyladenine, and the synthetic substituted urea cytokinin thidiazuron are also inactive, as are most cytokinin glucosides and the monophosphate N6-(DELTA2-isopentenyl)adenosine-5'-monophosphate
-
-
?
additional information
?
-
-
adenosine, abscisic acid, gibberellic acid, and cis-zeatin riboside are no substrates, nor is the reduced dihydrozeatin. Aromatic cytokinins, kinetin and N6-benzyladenine, and the synthetic substituted urea cytokinin thidiazuron are also inactive, as are most cytokinin glucosides and the monophosphate N6-(DELTA2-isopentenyl)adenosine-5'-monophosphate
-
-
?
additional information
?
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
additional information
?
-
specificity for electron acceptors, overview
-
-
?
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
cis-zeatin + acceptor + H2O
?
-
-
-
-
?
cis/trans-zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-(2-isopentenyl)adenine + FAD
adenine + 3-methylbut-2-enal + FADH2
the natural terminal electron acceptor probably is a p-quinone or a similar compound, high substrate specificity for N6-(2-isopentenyl)adenine
-
-
?
N6-(2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
ir
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O
adenosine + 3-methylbut-2-enal + FADH2
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
N6-isopentenyladenine + electron acceptor
adenine + 3-methyl-2-butenal + reduced electron acceptor
-
-
-
ir
N6-isopentenyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
oxidative degradation
-
-
ir
trans-zeatin + acceptor + H2O
?
trans-zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + electron acceptor
4-hydroxy-3-methylbut-2-enal + adenine + reduced electron acceptor
-
-
-
ir
zeatin + FAD + H2O
adenine + 4-hydroxy-3-methylbut-2-enal + FADH2
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
additional information
?
-
N6-(DELTA2-isopentenyl)adenine + FAD + H2O

adenine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
oxidative degradation of cytokinins
-
-
ir
N6-(DELTA2-isopentenyl)adenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O

adenosine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-(DELTA2-isopentenyl)adenosine + FAD + H2O
adenosine + 3-methylbut-2-enal + FADH2
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O

adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + acceptor + H2O
adenine + 3-methylbut-2-enal + reduced acceptor
-
-
-
-
?
N6-dimethylallyladenine + FAD + H2O

adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
Phaseolus sp.
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
-
-
-
-
?
N6-dimethylallyladenine + FAD + H2O
adenine + 3-methylbut-2-enal + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
trans-zeatin + acceptor + H2O

?
-
-
-
-
?
trans-zeatin + acceptor + H2O
?
-
-
-
-
?
zeatin + FAD + H2O

adenine + ? + FADH2
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
-
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
Phaseolus sp.
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
zeatin + FAD + H2O
adenine + ? + FADH2
-
enzyme catalyzes the irreversible degradation of cytokinins
-
-
ir
additional information

?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, by controlling the cytokinin level enzyme controls proliferation and differentiation of plant cells
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
analysis of enzyme activity regulation
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes
-
-
?
additional information
?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
endogenous cytokinin levels after induction with N6-benzylaminopurine, overview, apoplastic enzyme degradation pathway
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
cytokinins stimulate pigment formation and nitrogen fixation
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
reduced expression of OsCKX2 causes cytokinin accumulation in inflorescence meristems and increases the number of reproductive organs, resulting in enhanced grain yield
-
-
?
additional information
?
-
Phaseolus sp.
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
-
enzyme expression changes differently due to stress response in the 2 pea cultivars
-
-
?
additional information
?
-
-
involvement of cytokinin oxidase/dehydrogenase in regulation of cytokinin levels in leaves
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, results suggest that CKX is responsible for the changes in endogenous cytokinin pool in gibberellic acid-treated plants and most probably this enzyme represents an important link in gibberellic acid/cytokinin cross talk
-
-
?
additional information
?
-
-
effects of exogenously applied auxins on cytokinin levels in seedlings, overview, exogenously applied cytokinins increase the glycosylation level of endogenous cytokinins, overview
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes during infection, cytokinins are involved in pathogenesis
-
-
?
additional information
?
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
additional information
?
-
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
additional information
?
-
enzyme has a major role in control of cytokinin plant hormone levels
-
-
?
additional information
?
-
-
enzyme has a major role in control of cytokinin plant hormone levels
-
-
?
additional information
?
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
-
enzyme has a regulatory role in cytokinin metabolism and cytokinin-dependent processes, influences chloroplast development
-
-
?
additional information
?
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, important for the regulation of early development of the plant embryo
-
-
?
additional information
?
-
-
irreversible oxidative cleavage of the N6-side chain of cytokinins, products are adenine and side-chain derived aldehyde, important for the regulation of early development of the plant embryo
-
-
?
additional information
?
-
enzyme expression is co-localized with laccase, enzyme activity probably is associated with plant phenolic oxidation
-
-
?
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
0.004 - 0.009
(2,6-dichloro-pyridin-4-yl)-carbamic acid benzyl ester
0.0002 - 0.039
(2-chloro-pyridin-4-yl)-carbamic acid 4-chloro-phenyl ester
0.005 - 0.13
1-(2-chloro-1-oxidopyridin-4-yl)-3-phenylurea
0.0001 - 0.006
1-imidazo[1,2-a]pyridin-7-yl-3-phenylurea
0.027
2-amino-6-(3-methoxyanilino)purine
Arabidopsis thaliana
-
-
0.0039
2-chloro-6-(3-chloroanilino)purine
Arabidopsis thaliana
-
-
0.0075
2-chloro-6-(3-fluoroanilino)purine
Arabidopsis thaliana
-
-
0.00375
2-chloro-6-(3-hydroxyanilino)purine
Arabidopsis thaliana
-
-
0.061
2-chloro-6-(3-methoxyanilino)-9-methylpurine
Arabidopsis thaliana
-
-
0.0019
2-chloro-6-(3-methoxyanilino)purine
Arabidopsis thaliana
-
-
0.0254
2-chloro-6-(4-chloroanilino)purine
Arabidopsis thaliana
-
-
0.05
2-chloro-6-(4-fluoroanilino)purine
Arabidopsis thaliana
-
-
0.08
2-chloro-6-anilinopurine
Arabidopsis thaliana
-
-
0.001
2-fluoro-6-(3-methoxyanilino)purine
Arabidopsis thaliana
-
-
0.014
2-nitro-6-(3-methoxyanilino)purine
Arabidopsis thaliana
-
-
0.0124
6-(3-methoxyanilino)purine
Arabidopsis thaliana
-
-
0.005 - 0.05
N-(1,2,3-thidiazol-5-yl)-N'-phenylurea
0.002 - 0.009
N-(2,6-dichloro-pyridin-4-yl)-N'-benzylurea
0.005 - 0.02
N-(2,6-dichloro-pyridin-4-yl)-N'-phenoxyurea
0.00008 - 0.0045
N-(2,6-dichloro-pyridin-4-yl)-N'-phenylurea
0.0011 - 0.002
N-(2,6-dichloropyridin-4-yl)-N'-benzyl-N'-methylurea
0.006 - 0.032
N-(2-amino-6-chloro-pyridin-4-yl)-N'-benzylurea
0.00004 - 0.0018
N-(2-amino-6-chloro-pyridin-4-yl)-N'-phenylurea
0.00004 - 0.035
N-(2-amino-pyridin-4-yl)-N'-phenylurea
0.006 - 0.022
N-(2-chloro-6-methoxy-pyridin-4-yl)-N'-benzylurea
0.0015 - 0.018
N-(2-chloro-pyridin-4-yl)-N'-benzylurea
0.035 - 0.055
N-(2-chloro-pyridin-4-yl)-N'-phenylurea
0.02 - 2
N6-but-2,3-dienyl-aminopurine
Solanum tuberosum
-
mechanism-based irreversible (suicide) inhibitor. IC50: 0.02 mM with N6-(2-isopentenyl)adenine as substrate, 0.0004 mM with N6-(2-isopentenyl)adenosine as substrate and less than 0.0001 mM with zeatin as substrate
0.029
thidiazuron
Arabidopsis thaliana
-
-
additional information
additional information
Arabidopsis thaliana
-
IC50-values above 0.1 mM for 2-chloro-6-(2-hydroxyanilino)purine, 2-chloro-6-(4-hydroxyanilino)purine, 2-chloro-6-(2-methoxyanilino)purine, 2-chloro-6-(4-methoxyanilino)purine, 2-methylthio-6-(3-methoxyanilino)purine and 2-chloro-6-(3-methoxyanilino)-9-isopropylpurine, no inhibition observed for 6-anilinopurine and trans-zeatin
-
0.004
(2,6-dichloro-pyridin-4-yl)-carbamic acid benzyl ester

Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.007
(2,6-dichloro-pyridin-4-yl)-carbamic acid benzyl ester
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.007
(2,6-dichloro-pyridin-4-yl)-carbamic acid benzyl ester
Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.009
(2,6-dichloro-pyridin-4-yl)-carbamic acid benzyl ester
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.0002
(2-chloro-pyridin-4-yl)-carbamic acid 4-chloro-phenyl ester

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.006
(2-chloro-pyridin-4-yl)-carbamic acid 4-chloro-phenyl ester
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.006
(2-chloro-pyridin-4-yl)-carbamic acid 4-chloro-phenyl ester
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.039
(2-chloro-pyridin-4-yl)-carbamic acid 4-chloro-phenyl ester
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.005
1-(2-chloro-1-oxidopyridin-4-yl)-3-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.015
1-(2-chloro-1-oxidopyridin-4-yl)-3-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.017
1-(2-chloro-1-oxidopyridin-4-yl)-3-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.13
1-(2-chloro-1-oxidopyridin-4-yl)-3-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.0001
1-imidazo[1,2-a]pyridin-7-yl-3-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.0004
1-imidazo[1,2-a]pyridin-7-yl-3-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.001
1-imidazo[1,2-a]pyridin-7-yl-3-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.006
1-imidazo[1,2-a]pyridin-7-yl-3-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.005
N-(1,2,3-thidiazol-5-yl)-N'-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.015
N-(1,2,3-thidiazol-5-yl)-N'-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.017
N-(1,2,3-thidiazol-5-yl)-N'-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.05
N-(1,2,3-thidiazol-5-yl)-N'-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.002
N-(2,6-dichloro-pyridin-4-yl)-N'-benzylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.003
N-(2,6-dichloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.004
N-(2,6-dichloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.009
N-(2,6-dichloro-pyridin-4-yl)-N'-benzylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.005
N-(2,6-dichloro-pyridin-4-yl)-N'-phenoxyurea

Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.005
N-(2,6-dichloro-pyridin-4-yl)-N'-phenoxyurea
Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.008
N-(2,6-dichloro-pyridin-4-yl)-N'-phenoxyurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.02
N-(2,6-dichloro-pyridin-4-yl)-N'-phenoxyurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.00008
N-(2,6-dichloro-pyridin-4-yl)-N'-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.0004
N-(2,6-dichloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.0005
N-(2,6-dichloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.0045
N-(2,6-dichloro-pyridin-4-yl)-N'-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.0011
N-(2,6-dichloropyridin-4-yl)-N'-benzyl-N'-methylurea

Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.0015
N-(2,6-dichloropyridin-4-yl)-N'-benzyl-N'-methylurea
Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.002
N-(2,6-dichloropyridin-4-yl)-N'-benzyl-N'-methylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.002
N-(2,6-dichloropyridin-4-yl)-N'-benzyl-N'-methylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.006
N-(2-amino-6-chloro-pyridin-4-yl)-N'-benzylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.022
N-(2-amino-6-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.024
N-(2-amino-6-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.032
N-(2-amino-6-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.00004
N-(2-amino-6-chloro-pyridin-4-yl)-N'-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.0006
N-(2-amino-6-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.0007
N-(2-amino-6-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.0018
N-(2-amino-6-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.00004
N-(2-amino-pyridin-4-yl)-N'-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.002
N-(2-amino-pyridin-4-yl)-N'-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.032
N-(2-amino-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.035
N-(2-amino-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.006
N-(2-chloro-6-methoxy-pyridin-4-yl)-N'-benzylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.015
N-(2-chloro-6-methoxy-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.02
N-(2-chloro-6-methoxy-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.022
N-(2-chloro-6-methoxy-pyridin-4-yl)-N'-benzylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.0015
N-(2-chloro-pyridin-4-yl)-N'-benzylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.003
N-(2-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.004
N-(2-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
0.018
N-(2-chloro-pyridin-4-yl)-N'-benzylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.035
N-(2-chloro-pyridin-4-yl)-N'-phenylurea

Zea mays
mutant enzyme L492A, pH and temperature not specified in the publication
0.042
N-(2-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
wild type enzyme, pH and temperature not specified in the publication
0.045
N-(2-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381A, pH and temperature not specified in the publication
0.055
N-(2-chloro-pyridin-4-yl)-N'-phenylurea
Zea mays
mutant enzyme E381S, pH and temperature not specified in the publication
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.
Please wait a moment until the data is sorted. This message will disappear when the data is sorted.