Information on EC 3.1.8.1 - aryldialkylphosphatase

Word Map on EC 3.1.8.1
Please wait a moment until all data is loaded. This message will disappear when all data is loaded.
Specify your search results
Select one or more organisms in this record:
Show additional data
Do not include text mining results
Include (text mining) results (more...)
Include results (AMENDA + additional results, but less precise; more...)


The expected taxonomic range for this enzyme is: Bacteria, Eukaryota, Archaea

EC NUMBER
COMMENTARY hide
3.1.8.1
-
RECOMMENDED NAME
GeneOntology No.
aryldialkylphosphatase
REACTION
REACTION DIAGRAM
COMMENTARY hide
ORGANISM
UNIPROT
LITERATURE
an aryl dialkyl phosphate + H2O = dialkyl phosphate + an aryl alcohol
show the reaction diagram
REACTION TYPE
ORGANISM
UNIPROT
COMMENTARY hide
LITERATURE
hydrolysis of phosphoric triester
-
-
-
-
PATHWAY
BRENDA Link
KEGG Link
MetaCyc Link
Aminobenzoate degradation
-
-
methyl parathion degradation
-
-
Microbial metabolism in diverse environments
-
-
paraoxon degradation
-
-
parathion degradation
-
-
degradation of aromatic, nitrogen containing compounds
-
-
SYSTEMATIC NAME
IUBMB Comments
aryltriphosphate dialkylphosphohydrolase
Acts on organophosphorus compounds (such as paraoxon) including esters of phosphonic and phosphinic acids. Inhibited by chelating agents; requires divalent cations for activity. Previously regarded as identical with EC 3.1.1.2 arylesterase.
CAS REGISTRY NUMBER
COMMENTARY hide
117698-12-1
-
ORGANISM
COMMENTARY hide
LITERATURE
UNIPROT
SEQUENCE DB
SOURCE
strain VKM B-1297
-
-
Manually annotated by BRENDA team
female
-
-
Manually annotated by BRENDA team
strain 10
-
-
Manually annotated by BRENDA team
-
-
-
Manually annotated by BRENDA team
Meles taxus
badger
-
-
Manually annotated by BRENDA team
no activity in aves
-
-
-
Manually annotated by BRENDA team
-
-
-
Manually annotated by BRENDA team
tufted apple bud moth, azinphosmethyl-resistant fifth instars
-
-
Manually annotated by BRENDA team
Plesiomonas sp.
strain M6, gene mpd
SwissProt
Manually annotated by BRENDA team
strain M6, gene mpd
SwissProt
Manually annotated by BRENDA team
strain C2-1, ORF ophc2
Uniprot
Manually annotated by BRENDA team
strain JS444
-
-
Manually annotated by BRENDA team
strain KT 2442, gene opd
-
-
Manually annotated by BRENDA team
strain BP303
-
-
Manually annotated by BRENDA team
strain BP303
-
-
Manually annotated by BRENDA team
-
-
-
Manually annotated by BRENDA team
strain P1 (DSM1616)
UniProt
Manually annotated by BRENDA team
-
-
-
Manually annotated by BRENDA team
GENERAL INFORMATION
ORGANISM
UNIPROT
COMMENTARY hide
LITERATURE
malfunction
-
paraoxonase 1 knockout mice are dramatically more sensitive than wild type mice to the toxicity of chlorpyrifos oxon and diazoxon and to a lesser extent the parent phosphorothioates, chlorpyrifos and diazinon
physiological function
SUBSTRATE
PRODUCT                       
REACTION DIAGRAM
ORGANISM
UNIPROT
COMMENTARY
(Substrate) hide
LITERATURE
(Substrate)
COMMENTARY
(Product) hide
LITERATURE
(Product)
Reversibility
r=reversible
ir=irreversible
?=not specified
(+)-cyclosarin + H2O
methyl-phosphonic acid monofluoride + cyclohexanol
show the reaction diagram
1,2,2-trimethylpropylmethylphosphonofluoridate + H2O
?
show the reaction diagram
-
-
-
-
?
1-methylethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
1-methylethyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
1-methylethyl 4-nitrophenyl (1-methylpropyl)phosphonate + H2O
4-nitrophenol + 1-methylethyl hydrogen (1-methylpropyl)phosphonate
show the reaction diagram
1-methylethyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + 1-methylethyl hydrogen methylphosphonate
show the reaction diagram
1-methylpropyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + 1-methylpropyl hydrogen methylphosphonate
show the reaction diagram
1-palmitoyl-2-(5-oxo)valeroyl-sn-glycero-3-phosphocholine + H2O
lysophosphatidylcholine + ?
show the reaction diagram
-
-
-
?
1-palmitoyl-2-(9-oxo)nonanoyl-sn-glycero-3-phosphocholine + H2O
?
show the reaction diagram
-
-
-
-
?
2,4-dinitrophenyl diethyl phosphate + H2O
2,4-dinitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
2,6-difluorophenyl diethyl phosphate + H2O
2,6-difluorophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
2-fluoro-4-nitrophenyl diethyl phosphate + H2O
2-fluoro-4-nitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
2-methylpropyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl N,N,N',N'-tetramethyldiamidophosphate + H2O
?
show the reaction diagram
-
-
-
-
?
3,5-dinitrophenyl diethyl phosphate + H2O
3,5-dinitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl 1-methylethyl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl 2-methylpropyl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl cyclohexyl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl diethyl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl dimethyl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl ethyl methylphosphonate + H2O
3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one + ethyl methylphosphonate
show the reaction diagram
-
-
-
-
?
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl ethyl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
3-cyanophenyl diethyl phosphate + H2O
3-cyanophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
3-fluoro-4-nitrophenyl diethyl phosphate + H2O
3-fluoro-4-nitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
3-fluorophenyl diethyl phosphate + H2O
3-fluorophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
3-nitrophenyl diethyl phosphate + H2O
3-nitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl (2R)-3,3-dimethylbutan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + (2R)-3,3-dimethylbutan-2-yl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl (2R)-3,3-dimethylbutan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + (2R)-3,3-dimethylbutan-2-yl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl (2S)-3,3-dimethylbutan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + 4-acetylphenol + (2S)-3,3-dimethylbutan-2-yl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl (2S)-3,3-dimethylbutan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + (2S)-3,3-dimethylbutan-2-yl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl 2-methylpropyl (R)-methylphosphonate + H2O
4-acetylphenol + 2-methylpropyl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl 2-methylpropyl (S)-methylphosphonate + H2O
4-acetylphenol + 2-methylpropyl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl cyclohexyl (R)-methylphosphonate + H2O
4-acetylphenol + cyclohexyl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl cyclohexyl (S)-methylphosphonate + H2O
4-acetylphenol + cyclohexyl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl ethyl (R)-methylphosphonate + H2O
4-acetylphenol + ethyl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl ethyl (S)-methylphosphonate + H2O
4-acetylphenol + ethyl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl propan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + propan-2-yl (R)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-acetylphenyl propan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + propan-2-yl (S)-methylphosphonate
show the reaction diagram
-
-
-
-
?
4-chlorophenyl diethyl phosphate + H2O
4-chlorophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-cyanophenyl diethyl phosphate + H2O
4-cyanophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-diethyl phosphate acetophenone + H2O
4-hydroxyacetophenone + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-diethyl phosphate benzaldehyde + H2O
4-hydroxybenzaldehyde + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-diethyl phosphate methyl benzoate + H2O
methyl 4-hydroxybenzoate + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-methyl-2-oxo-2H-chromen-7-yl 2-methylpropyl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
4-methyl-2-oxo-2H-chromen-7-yl N,N,N',N'-tetramethyldiamidophosphate + H2O
?
show the reaction diagram
-
-
-
-
?
4-nitrophenolate + H2O
?
show the reaction diagram
4-nitrophenyl butanoate + H2O
4-nitrophenol + butanoate
show the reaction diagram
4-nitrophenyl diethyl phosphate + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
4-nitrophenyl phenyl methylphosphonate + H2O
4-nitrophenol + phenyl hydrogen methylphosphonate
show the reaction diagram
4-nitrophenyl phenyl methylphosphonate + H2O
phenyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
wild-type, 78% of the activity with propyl 4-nitrophenyl methylphosphonate
-
-
?
4-nitrophenyl phosphate + H2O
4-nitrophenol + phosphate
show the reaction diagram
4-nitrophenyl propan-2-yl methylphosphonate + H2O
propan-2-yl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
wild-type, 57% of the activity with propyl 4-nitrophenyl methylphosphonate
-
-
?
4-nitrophenyl propyl methylphosphonate + H2O
4-nitrophenol + propyl hydrogen methylphosphonate
show the reaction diagram
7-diethylphospho-6,8-difluor-4-methylumbelliferyl + H2O
diethylphosphate + 6,8-difluor-4-methylumbelliferol
show the reaction diagram
-
high level of hydrolysis of the fluorogenic substrate, fluorescence assay method optimization
-
-
?
7-diethylphosphoro-3-cyanocoumarin + H2O
3-cyanocoumarin + diethyl phosphate
show the reaction diagram
-
-
-
-
?
7-O-diethylphosphoryl-3-cyano-7-hydroxycoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
acephate + H2O
?
show the reaction diagram
bis(1-methylethyl) 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
bis(1-methylethyl) 4-methyl-2-oxo-2H-chromen-7-yl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
butan-2-yl 4-nitrophenyl methylphosphonate + H2O
butan-2-yl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
wild-type, 50% of the activity with propyl 4-nitrophenyl methylphosphonate
-
-
?
chlorpyrifos + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl thiophosphate
show the reaction diagram
chlorpyrifos + H2O
?
show the reaction diagram
-
-
-
-
?
chlorpyrifos oxon + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl phosphate
show the reaction diagram
chlorpyrifos oxon + H2O
?
show the reaction diagram
-
-
-
?
chlorpyrifos-oxon + H2O
3,5,6-trichloro-2-pyridinol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
chlorpyrifos-oxon + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
chlorpyrifos-oxon + H2O
?
show the reaction diagram
chlorpyriphosoxon + H2O
?
show the reaction diagram
-
-
-
-
?
chlortion + H2O
?
show the reaction diagram
-
chlorthion is O,O-dimethyl O-(3-chloro-4-nitrophenyl) thionophosphate
-
-
?
CMP-coumarin + H2O
?
show the reaction diagram
-
-
-
-
?
coroxon + H2O
?
show the reaction diagram
-
-
-
-
?
coumaphos + H2O
3-chloro-4-methylumbelliferone + diethyl thiophosphate
show the reaction diagram
coumaphos + H2O
?
show the reaction diagram
CVX + H2O
?
show the reaction diagram
cyclohexyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
cyclohexyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
cyclosarin + H2O
?
show the reaction diagram
-
-
-
-
?
cyclosarin + H2O
methyl-phosphonic acid monofluoride + cyclohexanol
show the reaction diagram
demethon-S + H2O
?
show the reaction diagram
demeton-S + H2O
2-ethylsulfanyl-ethanethiol + diethyl phosphate
show the reaction diagram
demeton-S methyl + H2O
2-ethylsulfanyl-ethanethiol + dimethyl phosphate
show the reaction diagram
-
-
-
-
?
demeton-S-methyl + H2O
2-ethylsulfanyl-ethanethiol + dimethyl phosphate
show the reaction diagram
-
-
-
-
?
diazinon + H2O
?
show the reaction diagram
diazoxon + H2O
2-isopropyl-6-methyl-pyrimidin-4-ol + diethyl phosphate
show the reaction diagram
diazoxon + H2O
6-methyl-2-(1-methylethyl)pyrimidin-4-ol + diethyl phosphate
show the reaction diagram
-
-
-
-
ir
diazoxon + H2O
?
show the reaction diagram
dichlorvos + H2O
2,2-dichloroethenol + dimethyl hydrogen phosphate
show the reaction diagram
-
-
-
?
diethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
diethyl 4-chlorophenyl phosphate + H2O
4-chlorophenol + diethyl phosphate
show the reaction diagram
diethyl 4-chlorophenyl thiophosphate + H2O
4-chlorophenol + diethyl thiophosphate
show the reaction diagram
-
-
-
-
?
diethyl 4-methylbenzylphosphonate + H2O
?
show the reaction diagram
-
-
-
?
diethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + diethyl hydrogen phosphate
show the reaction diagram
diethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
-
-
-
-
?
diethyl paraoxon + H2O
?
show the reaction diagram
diisopropyl fluorophosphate + H2O
?
show the reaction diagram
diisopropyl fluorophosphate + H2O
isopropanol + ?
show the reaction diagram
-
-
-
-
?
diisopropylfluorophosphate + H2O
?
show the reaction diagram
dimefox + H2O
?
show the reaction diagram
-
-
-
-
?
dimethoate + H2O
?
show the reaction diagram
dimethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
dimethyl 4-methyl-2-oxo-2H-chromen-7-yl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
dimethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + dimethyl hydrogen phosphate
show the reaction diagram
13.3% relative specific activity compared to methyl 1-methylethyl 4-nitrophenyl phosphate
-
-
?
dimethyl paraoxon + H2O
?
show the reaction diagram
ethyl 1-methylethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + ethyl 1-methylethyl hydrogen phosphate
show the reaction diagram
ethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
ethyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
?
show the reaction diagram
-
-
-
-
?
ethyl 4-nitrophenyl (1-methylpropyl)phosphonate + H2O
4-nitrophenol + ethyl hydrogen (1-methylpropyl)phosphonate
show the reaction diagram
ethyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + ethyl hydrogen methylphosphonate
show the reaction diagram
ethyl 4-nitrophenyl methylphosphonate + H2O
ethyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
wild-type, 50% of the activity with propyl 4-nitrophenyl methylphosphonate
-
-
?
ethyl paraoxon + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
ethyl paraoxon + H2O
?
show the reaction diagram
-
-
-
-
?
ethyl parathion + H2O
?
show the reaction diagram
-
-
-
-
?
ethyl phenyl parathion
?
show the reaction diagram
-
-
-
-
?
ethyl-paraoxon + H2O
?
show the reaction diagram
fenitroxon + H2O
?
show the reaction diagram
-
-
-
-
?
fensulfothion + H2O
?
show the reaction diagram
-
-
-
?
isopropyl methylphosphonofluoridate + H2O
?
show the reaction diagram
-
-
-
-
?
malathion + H2O
2-nitro-5-thiobenzoate + ?
show the reaction diagram
-
-
-
-
?
malathion + H2O
?
show the reaction diagram
malathion + H2O
malic acid diethylester + O,O-dimethyl dithiophosphate
show the reaction diagram
methyl 1-methylethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + methyl 1-methylethyl hydrogen phosphate
show the reaction diagram
100% activity
-
-
?
methyl 4-nitrophenyl methylphosphonate + H2O
methyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
wild-type, 733% of the activity with propyl 4-nitrophenyl methylphosphonate
-
-
?
methyl chlorpyrifos oxon + H2O
?
show the reaction diagram
-
-
-
?
methyl chlorpyrifos thion + H2O
?
show the reaction diagram
-
-
-
?
methyl paraoxon + H2O
4-nitrophenol + dimethyl phosphate
show the reaction diagram
methyl paraoxon + H2O
4-nitrophenol + dimethylphosphate
show the reaction diagram
-
the enzyme reaction also produces two protons, which lower the pH and establish a steady pH gradient
-
-
?
methyl paraoxon + H2O
4-nitrophenol + methyl diethyl phosphate
show the reaction diagram
methyl paraoxon + H2O
?
show the reaction diagram
-
-
-
-
?
methyl parathion + H2O
4-nitrophenol + dimethyl thiophosphate
show the reaction diagram
methyl parathion + H2O
?
show the reaction diagram
methyl parathion + H2O
methyl diethylthiophosphate + 4-nitrophenol
show the reaction diagram
mono(diethylphosphoryl)obidoxime + H2O
diethyl hydrogenphosphate + obidoxime
show the reaction diagram
-
substrate is a potent inhibitor of human acetylcholinesterase
-
-
?
N-[2-[ethoxy(methyl)phosphoryl]sulfanethyl]-N-propan-2-ylpropan-2-amine + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
-
the enzyme shows only minimal activity against the nerve agent VX
-
-
-
nitrophenyl isopropyl methylphosphonate + H2O
nitrophenol + propan-2-yl hydrogen methylphosphonate
show the reaction diagram
-
a series of substituted phenoxyalkyl pyridinium oximes enhance the degradation of surrogates of sarin (i.e. nitrophenyl isopropyl methylphosphonate, NIMP) and VX (i.e. nitrophenyl ethyl methylphosphonate, NEMP). Neither NIMP nor NEMP is hydrolyzed effectively by paraoxonase PON1 if one of these oximes is absent. In the presence of eight novel oximes, PON1-mediated degradation of both surrogates occurs
-
-
?
O,O-diisopropyl-4-nitrophenyl phosphate + H2O
dipropan-2-yl hydrogen phosphate + 4-nitrophenol
show the reaction diagram
-
-
-
-
?
O,O-dimethyl O-(4-methyl-2-oxo-2H-chromen-7-yl) thiophosphate + H2O
?
show the reaction diagram
-
-
-
-
?
O,O-dimethyl O-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl] thiophosphate + H2O
?
show the reaction diagram
-
-
-
-
?
O-ethyl O-4-nitrophenyl phenylphosphonothioate + H2O
?
show the reaction diagram
-
-
-
-
?
O-ethyl S-(2-diisopropylaminoethyl) methylphosphonothioate + H2O
?
show the reaction diagram
-
i.e. VX, a highly toxic organophosphorus nerve agent, stereospecific hydrolysis
-
-
?
O-ethyl S-(2-diisopropylaminomethyl)methylphosphonothioate + H2O
?
show the reaction diagram
also called VX
-
-
?
O-ethyl S-2-diisopropylaminoethyl methylphosphonothiolate + H2O
?
show the reaction diagram
-
-
-
-
?
O-ethyl-S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
-
hydrolysis is exclusively preferential for the P+ isomer. Glycosylation state of PON1 does not affect substrate stereoselectivity
-
-
?
O-ethyl-S-[2-(diisopropylamino)ethyl]methylphosphonothioate + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
-
O-ethyl-S-[2-(diisopropylamino)ethyl]methylphosphonothiate's lone oxygen atom has a strong preference for forming a direct electrostatic interaction with PON1's active site calcium ion. Key residues, which interact with VX are E53, H115, N168, F222, N224, L240, D269, I291, F292, and V346. Residue D183 located in PON1's active site may act as a proton donor or accepter during hydrolysis. PON1's flexible loop region acts as a gatekeeper to the active site residues required for binding VX
-
-
?
O-isobutyl S-(N,N-diethylaminoethyl)methylphosphonothioate + H2O
?
show the reaction diagram
also called VR
-
-
?
O-isobutyl-S-[2-(diethylamino)ethyl]methylphosphonothioic acid + H2O
?
show the reaction diagram
-
hydrolysis is exclusively preferential for the P+ isomer. Glycosylation state of PON1 does not affect substrate stereoselectivity
-
-
?
O-methyl O-(4-nitrophenyl) methylphosphonothioate + H2O
O-methyl-methylphosphonothionic acid + 4-nitrophenol
show the reaction diagram
-
-
-
-
?
paraoxon + H2O
4-nitrophenol + di-ethyl phosphate
show the reaction diagram
-
-
-
-
?
paraoxon + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
paraoxon + H2O
4-nitrophenol + diethylphosphate
show the reaction diagram
paraoxon + H2O
4-nitrophenol + dimethylphosphate
show the reaction diagram
-
-
-
?
paraoxon + H2O
?
show the reaction diagram
paraoxon + H2O
diethyl phosphate + 4-nitrophenol
show the reaction diagram
paraoxon + H2O
diethylphosphate + 4-nitrophenol
show the reaction diagram
parathion + H2O
4-nitrophenol + diethyl thiophosphate
show the reaction diagram
parathion + H2O
?
show the reaction diagram
parathion + H2O
diethylthiophosphate + 4-nitrophenol
show the reaction diagram
pentafluorophenyl diethyl phosphate + H2O
?
show the reaction diagram
-
-
-
-
?
phenyl acetate + H2O
phenol + acetate
show the reaction diagram
phosalone + H2O
?
show the reaction diagram
-
-
-
-
?
phosmet + H2O
N-hydroxymethyl-phthalimide + O,O-dimethyl dithiophosphate
show the reaction diagram
-
-
-
-
?
phosphatidylcholine isoprostane + H2O
?
show the reaction diagram
-
-
-
-
?
pirimiphos-methyloxon + H2O
?
show the reaction diagram
propyl 4-nitrophenyl methylphosphonate + H2O
propyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
-
-
-
-
?
RP-O-ethyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
RP-O-n-propyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
russian VX + H2O
methyl-phosphonothioic acid S-(2-diethylamino-ethyl) ester + 2-methylpropanol
show the reaction diagram
S-(2-[di(propan-2-yl)amino]ethyl)O-ethyl methylphosphonothioate
O-ethyl hydrogen methylphosphonothioate + 2-[di(propan-2-yl)amino]ethanol
show the reaction diagram
-
i.e. nerve agent VX
-
-
?
sarin + H2O
?
show the reaction diagram
sarin + H2O
methyl-phosphonic acid monofluoride + isopropyl alcohol
show the reaction diagram
sarin + H2O
methylphosphonofluoride acid + ?
show the reaction diagram
soman + H2O
?
show the reaction diagram
soman + H2O
methyl-phosphonic acid monofluoride + 1,2,2-trimethylpropanol
show the reaction diagram
soman + H2O
methylphosphonofluoride acid + 3,3-dimethylbutan-2-ol
show the reaction diagram
SP-O-ethyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
SP-O-n-propyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
tabun + H2O
?
show the reaction diagram
tabun + H2O
cyanophosphonic acid dimethylamide + ethanol
show the reaction diagram
trimethyl phosphate + H2O
?
show the reaction diagram
-
-
-
?
VR + H2O
?
show the reaction diagram
VX + H2O
?
show the reaction diagram
VX + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
additional information
?
-
NATURAL SUBSTRATES
NATURAL PRODUCTS
REACTION DIAGRAM
ORGANISM
UNIPROT
COMMENTARY
(Substrate) hide
LITERATURE
(Substrate)
COMMENTARY
(Product) hide
LITERATURE
(Product)
REVERSIBILITY
r=reversible
ir=irreversible
?=not specified
additional information
?
-
METALS and IONS
ORGANISM
UNIPROT
COMMENTARY hide
LITERATURE
CaCl2
-
added to optimized fluorescence assay
Cu2+
-
activates
Mg2+
-
the enzyme depends on divalent metal ions with Co2+, Mg2+, and Ni2+ being the most effective
additional information