Any feedback?
Please rate this page
(all_enzymes.php)
(0/150)

BRENDA support

3.4.22.2: papain

This is an abbreviated version!
For detailed information about papain, go to the full flat file.

Word Map on EC 3.4.22.2

Reaction

Hydrolysis of proteins with broad specificity for peptide bonds, but preference for an amino acid bearing a large hydrophobic side chain at the P2 position. Does not accept Val in P1' =

Synonyms

Adolph's Meat Tenderizer, arbuz, CpXCP5, EC 3.4.4.10, enzeco papain, papain, papain-like cysteine protease, papain-like protease, papaine, papaya peptidase I, papaya proteinase 1, Papaya proteinase I, papayotin, PLCP, PLpro, PPI, summetrin, velardon

ECTree

     3 Hydrolases
         3.4 Acting on peptide bonds (peptidases)
             3.4.22 Cysteine endopeptidases
                3.4.22.2 papain

Substrates Products

Substrates Products on EC 3.4.22.2 - papain

Please wait a moment until all data is loaded. This message will disappear when all data is loaded.
SUBSTRATE
PRODUCT                       
REACTION DIAGRAM
ORGANISM
UNIPROT
COMMENTARY
(Substrate) hide
LITERATURE
(Substrate)
COMMENTARY
(Product) hide
LITERATURE
(Product)
Reversibility
r=reversible
ir=irreversible
?=not specified
(RS)-mandelic hydrazide + benzyloxycarbonyl-Ala
N1-(benzyloxycarbonyl-Ala)-N2-[(R)-mandelyl]hydrazine + N1-(benzyloxycarbonyl-Ala)-N2-[(S)-mandelyl]hydrazine
show the reaction diagram
-
-
mixture of diastereoisomers containing 73% N1-(benzyloxycarbonyl-Ala)-N2-[(R)-mandelyl]hydrazine
?
(RS)-mandelic hydrazide + benzyloxycarbonyl-Gly
N1-(benzyloxycarbonyl-Gly)-N2-[(R)-mandelyl]hydrazine + N1-(benzyloxycarbonyl-Gly)-N2-[(S)-mandelyl]hydrazine
show the reaction diagram
-
-
-
?
(RS)-mandelic hydrazide + hippuric acid
?
show the reaction diagram
-
-
-
-
?
(RS)-mandelic hydrazide + N(tert-amyloxycarbonyl)-Gly
(+)-N1-(tert-amyloxycarbonyl-Gly)-NH2-[(R)-mandelyl]hydrazine + N1-(tert-butoxycarbonyl-Gly)-N2-[(S)-mandelyl]hydrazine
show the reaction diagram
-
-
-
?
(RS)-mandelic hydrazide + N-(tert-butyloxycarbonyl)-Gly
(+)-N1-(tert-butyloxycarbonyl-Gly)-N2[(R)-mandelyl]hydrazine + (+)-(N1)-(tert-butyloxycarbonyl-Gly)-N2[(S)-mandelyl]hydrazine
show the reaction diagram
-
-
-
-
?
2-(amino)ethyl 2'-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
3-(amino)trimethylene 2'-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
4-(amino)-tetramethylene 2'-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
Ac-L-Phe-Gly 4-nitroanilide + H2O
Ac-L-Phe-Gly + 4-nitroaniline
show the reaction diagram
-
whole hydrolysis process includes two stages: acylation and deacylation. The first step is a proton transfer to form a zwitterionic form (i.e. Cys-S-/His-H+ion-pair), and the second step is the nucleophilic attack on the carboxyl carbon of the substrate accompanied with the dissociation of 4-nitroaniline. The deacylation stage includes the nucleophilic attack of a water molecule on the carboxyl carbon of the substrate and dissociation between the carboxyl carbon of the substrate and the sulfhydryl sulfur of Cys25 side chain. The acylation is rate-limiting
-
-
?
acetyl-Ala-Ala-Ala-p-nitroanilide + H2O
?
show the reaction diagram
-
-
-
?
acetyl-L-Phe-Gly-4-nitroanilide + H2O
acetyl-L-Phe-Gly + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
alpha-lactalbumin + H2O
?
show the reaction diagram
-
-
-
-
?
alpha-N-benzoyl-DL-Arg-p-nitroanilide + H2O
?
show the reaction diagram
-
-
-
?
azocasein + H2O
?
show the reaction diagram
-
-
-
-
?
azocasein + H2O
azopeptide + peptides
show the reaction diagram
-
-
-
?
benzaldehyde + acetylacetone
3-benzylidenepentane-2,4-dione
show the reaction diagram
-
35% yield after 72 h at 25°C or 55% yield after 81 h at 60°C. 150 mg of papain is the optimum quantity for the Knoevenagel reaction between 2 mM of benzaldehyde and 2.4 mM of acetylacetone in 5 ml of DMSO/H2O
-
-
?
benzoyl arginine ethyl ester + H2O
?
show the reaction diagram
-
pH 6.3, 20°C
-
-
?
benzoyl-L-Arg-2-naphthylamide + H2O
benzoyl-L-Arg + 2-naphthylamine
show the reaction diagram
-
-
-
-
?
benzoyl-thiocarbamic acid + H2O
N-benzoyl-Gly + SH2
show the reaction diagram
-
-
-
-
?
benzoyl-thiocarbamic acid ethyl ester + H2O
N-benzoyl-Gly + ethanethiol
show the reaction diagram
-
-
-
-
?
benzoyl-thiocarbamic acid methyl ester + H2O
N-benzoyl thioglycine + methanol
show the reaction diagram
-
-
-
-
?
benzyl-Phe-Val-Arg-4-nitroanilide + H2O
benzyl-Phe-Val-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Ala methyl ester + L-Arg
benzyloxycarbonyl-Ala-Arg-OH
show the reaction diagram
-
-
-
?
benzyloxycarbonyl-Ala-Arg-NH2 + Arg-NH2
benzyloxycarbonyl-Ala-Arg-Arg-NH2
show the reaction diagram
-
-
-
?
benzyloxycarbonyl-Ala-OMe + 4-aminoantipyrine
benzyloxycarbonyl-Ala-4-aminoantipyrine + methanol
show the reaction diagram
-
-
-
?
benzyloxycarbonyl-Arg-Arg 4-methylcoumarin-7-amide + H2O
?
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-citrullyl-Arg 4-methylcoumarin-7-amide + H2O
?
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Gly-OMe + 4-aminoantipyrine
benzyloxycarbonyl-Gly-4-aminoantipyrine + methanol
show the reaction diagram
-
-
-
?
benzyloxycarbonyl-L-citrullyl-L-Arg-7-amido-4-methylcoumarin + H2O
benzyloxycarbonyl-L-citrullyl-L-Arg + 7-amino-4-methylcoumarin
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-L-Phe-L-Arg-7-amido-4-methylcoumarin + H2O
benzyloxycarbonyl-L-Phe-L-Arg + 7-amino-4-methylcoumarin
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Phe-Arg 4-methylcoumarin-7-amide + H2O
?
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Phe-Arg-4-methylcoumaryl-7-amide + H2O
?
show the reaction diagram
-
-
-
?
benzyloxycarbonyl-Phe-Arg-4-nitroanilide + H2O
benzyloxycarbonyl-Phe-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Phe-Leu-4-nitroanilide + H2O
benzyloxycarbonyl-Phe-Leu + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
benzyloxycarbonyl-Ser-OMe + 4-aminoantipyrine
benzyloxycarbonyl-Ser-4-aminoantipyrine + methanol
show the reaction diagram
-
-
-
?
beta-lactoglobulin + H2O
?
show the reaction diagram
-
-
-
-
?
Bovine serum albumin + H2O
?
show the reaction diagram
-
-
-
-
?
carboxybenzoyl-Phe-Arg-7-(4-methyl)coumarylamide + H2O
carboxybenzoyl-Phe-Arg + 7-amino-4-methylcoumarin
show the reaction diagram
fluorogenic substrate
-
-
?
casein + H2O
?
show the reaction diagram
casein + H2O
L-tyrosine + ?
show the reaction diagram
-
-
-
-
?
CBZ-beta-Ala 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-beta-Ala-L-Phe-NH2 + CBZ-beta-Ala + 4-guanidinophenol
show the reaction diagram
-
-
31.6% yield of CBZ-beta-Ala-L-Phe-NH2
-
?
CBZ-D-Ala 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-D-Ala-L-Phe-NH2 + CBZ-D-Ala + 4-guanidinophenol
show the reaction diagram
-
-
11.6% yield of CBZ-D-Ala-L-Phe-NH2
-
?
CBZ-Gly 4-guanidinophenyl ester + D-Phe-NH2 + H2O
CBZ-Gly-D-Phe-NH2 + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
22.9% yield for CBZ-Gly-D-Phe-NH2 and 74.3% yield for CBZ-Gly
-
?
CBZ-Gly 4-guanidinophenyl ester + H2O
CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
94.8% yield for CBZ-Gly
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Ala 4-nitroanilide + H2O
CBZ-Gly-L-Ala 4-nitroanilide + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
96% yield for CBZ-Gly-L-Ala 4-nitroanilide
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Ala-NH2 + H2O
CBZ-Gly-L-Ala-NH2 + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
87% yield for Gly-L-Ala-NH2 and 7.7% yield for Gly-OH
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Phe tert-butyl ester + H2O
CBZ-Gly-L-Phe tert-butyl ester + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
11.8% yield for CBZ-Gly-L-Phe tert-butyl ester
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-Gly-L-Phe-NH2 + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
92% yield of CBZ-Gly-L-Phe-NH2
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Pro 4-nitroanilide + H2O
CBZ-Gly-L-Pro 4-nitroanilide + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
90.3% yield for CBZ-Gly
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Ser 4-nitroanilide + H2O
CBZ-Gly-L-Ser 4-nitroanilide + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
94% yield for CBZ-Gly-L-Ser 4-nitroanilide
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Tyr 4-nitroanilide + H2O
CBZ-Gly-L-Tyr 4-nitroanilide + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
90.6% yield for CBZ-Gly-L-Tyr 4-nitroanilide and 4.3% yield for CBZ-Gly
-
?
CBZ-Gly 4-guanidinophenyl ester + L-Tyr-NH2 + H2O
CBZ-Gly-L-Tyr-NH2 + CBZ-Gly + 4-guanidinophenol
show the reaction diagram
-
-
91.3% yield for CBZ-Gly-L-Tyr-NH2 and 2.5% yield for CBZ-Gly
-
?
CBZ-L-Ala 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-L-Ala-L-Phe-NH2 + CBZ-L-Ala + 4-guanidinophenol
show the reaction diagram
-
-
77.5% yield of CBZ-L-Ala-L-Phe-NH2
-
?
CBZ-L-Arg 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-L-Arg-L-Phe-NH2 + CBZ-L-Arg + 4-guanidinophenol
show the reaction diagram
-
-
45.9% yield of CBZ-L-Arg-L-Phe-NH2
-
?
CBZ-L-Asn 4-guanidinophenyl ester + L-Phe-NH2 + H2O
L-Asn-L-Phe-NH2 + CBZ-L-Asn + 4-guanidinophenol
show the reaction diagram
-
-
6.1% yield of CBZ-L-Asn-L-Phe-NH2
-
?
CBZ-L-Glu 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-Glu-L-Phe-NH2 + CBZ-L-Glu + 4-guanidinophenol
show the reaction diagram
-
-
68.5% yield of CBZ-L-Glu-L-Phe-NH2
-
?
CBZ-L-Ile 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-L-Ile-L-Phe-NH2 + CBZ-L-Ile + 4-guanidinophenol
show the reaction diagram
-
-
24.5% yield of CBZ-L-Ile-L-Phe-NH2
-
?
CBZ-L-Thr 4-guanidinophenyl ester + L-Phe-NH2 + H2O
CBZ-L-Thr-L-Phe-NH2 + CBZ-L-Thr + 4-guanidinophenol
show the reaction diagram
-
-
90.7% yield of CBZ-L-Thr-L-Phe-NH2
-
?
CH3-CH2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-(D-Phe)-NH-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-(D-Phe)-O-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-(L-Phe)-NH-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-(L-Phe)-O-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-NH-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
CH3CO-O-[CH2]2-2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
chicken IgY + H2O
?
show the reaction diagram
-
-
-
-
?
chitosan + H2O
low molecular weight chitosan + ?
show the reaction diagram
the enzymolysis process is analyzed using pseudo-first-order and pseudo-second-order kinetic models and the experiment data are more consistent with the pseudo-second-order kinetic model. The Haldane kinetic model adequately describes the dynamic behavior of the chitosan enzymolysis by papain. When the initial chitosan concentration is above 8.0 g/l, the papain is overloaded and exhibits significant inhibition
-
-
?
chitosan + H2O
low-molecular mass chitosan + chito-oligomeric-monomeric mixture
show the reaction diagram
CopA + H2O
?
show the reaction diagram
-
CopA is a bacterial Cu+-ATPase from Thermotoga maritima and contains 3 papain cleavage sites on the C-terminal side of the N-terminal metal binding domain
-
-
?
cucurbitin + H2O
?
show the reaction diagram
-
the reaction occurs in two successive steps. In the first step, limited proteolysis consisting of detachments of short terminal peptides from the alpha and beta chains are observed. The cooperative proteolysis, which occurs as a pseudo-first order reaction, started at the second step. The limited proteolysis at the first step plays a regulatory role, impacting the rate of deep degradation of cucurbitin molecules by the cooperative mechanism
-
-
?
Dabcyl-Lys-Phe-Gly-Gly-Ala-Ala-Edans + H2O
Dabcyl-Lys-Phe-Gly + Gly-Ala-Ala-Edans
show the reaction diagram
DL-4-hydroxyphenylglycine methyl ester + H2O
?
show the reaction diagram
-
asymmetric hydrolysis
-
-
?
fibroin + H2O
?
show the reaction diagram
-
-
upon papain hydrolysis of fibroin composed of highly repetitive Ala- and Gly-rich blocks even-numbered peptides are obtained. The even-numbered peptides are in the forms of di-, tetra-, hexa-, and octa-peptides with repeating units in combination of Ala-Gly, Ser-Gly, Tyr-Gly, and Val-Gly. The sequences of the tetra-peptides are in the order of Ala-Gly-X-Gly, where X is Tyr or Val
-
?
fish IgM + H2O
?
show the reaction diagram
-
-
-
-
?
Glucagon + H2O
?
show the reaction diagram
-
-
-
-
?
Hemoglobin + H2O
?
show the reaction diagram
-
alpha-chain and beta-chain
-
-
?
hippuric acid + aniline
hippuryl anilide
show the reaction diagram
-
weak activity, 0.1% of the hydrolytic activity with N-benzoyl-L-argininamide
-
r
human IgG + H2O
fragment Fab + fragment Fc
show the reaction diagram
-
-
-
?
immunoglobulin M + H2O
IgMI +
show the reaction diagram
-
release of a basic subunit-like fragment which is designated IgMI, by proteolysis of the mü-chain near the carboxyl terminus
-
?
L-Arg-7-amido-4-methylcoumarin + H2O
L-Arg + 7-amino-4-methylcoumarin
show the reaction diagram
-
-
-
-
?
L-glutamic acid diethyl ester + L-glutamic acid diethyl ester
L-Glu-gamma-diethyl ester polymer
show the reaction diagram
-
polymerization reaction
-
-
?
L-glutamic acid diethyl ester + L-glutamic acid diethyl ester
oligo-gamma-ethyl-L-glutamate
show the reaction diagram
-
oligomerization reaction
-
-
?
L-glutamic acid diethyl ester + N-alpha-benzoyl-L-arginine ethyl ester
N-alpha-benzoyl-L-argininyl-L-glutamte-diethyl ester + ethanol
show the reaction diagram
-
-
-
-
?
L-glutamic acid triethyl ester + N-alpha-benzoyl-L-arginine ethyl ester
N-alpha-benzoyl-L-arginine + N-alpha-benzoyl-L-argininyl-Glu-Glu-triethyl ester
show the reaction diagram
-
L-glutamic acid triethyl ester shows higher affinity for papain than L-glutamic acid diethyl ester
-
-
?
L-phenylalanine amide + H2O
L-phenylalanine + NH3
show the reaction diagram
-
-
-
-
?
L-Pro-L-Phe-L-Leu-4-nitroanilide + H2O
L-Pro-L-Phe-L-Leu + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
L-Pro-Phe-Leu-4-nitroanilide + H2O
L-Pro-Phe-Leu + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
lambda repressor + H2O
?
show the reaction diagram
-
no cleavage of the operator-bound repressor dimer
-
?
lipid transfer protein + H2O
?
show the reaction diagram
-
-
-
-
?
low molecular weight heparin + H2O
?
show the reaction diagram
-
-
-
-
?
methyl red-Abu-Ala-Pro-Val-Lys-Lys(N5-(5-carboxyfluorescein))-NH2 + H2O
?
show the reaction diagram
-
pH 6.2 or pH 7.4, 10 min, 37°C
-
-
?
methyl red-Abu-Ala-Pro-Val-Lys-Lys(N5-(5-carboxyfluorescein))-NH2 + H2O
methyl red-Abu-Ala-Pro-Val-Lys + Lys(N5-(5-carboxyfluorescein))-NH2
show the reaction diagram
-
FRET 2, fluorescence resonance energy transfer peptide 2
-
-
?
methyl red-Abu-Ser-Ala-Pro-Val-Lys-Ala-Lys(N5-(5-carboxyfluorescein))-NH2 + H2O
?
show the reaction diagram
-
pH 6.2 or pH 7.4, 10 min, 37°C
-
-
?
methyl red-Abu-Ser-Ala-Pro-Val-Lys-Ala-Lys(N6-(5-carboxyfluorescein))-NH2 + H2O
methyl red-Abu-Ser-Ala-Pro-Val-Lys + Ala-Lys(N6-(5-carboxyfluorescein))-NH2
show the reaction diagram
-
FRET 1, fluorescence resonance energy transfer peptide 1
-
-
?
N(beta-phenylpropionyl)Gly methyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N,N-diBoc-dityrosine-(isoniazid)2 + H2O
?
show the reaction diagram
-
-
-
-
?
N-(beta-phenylpropionyl)Gly methyl thiono ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-acetyl-L-Trp p-nitrophenyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-acetyl-L-tyrosinamide + H2O
N-acetyl-L-Tyr + NH3
show the reaction diagram
-
-
-
-
?
N-alpha-benzoyl-DL-Arg-4-nitroanilide + H2O
N-alpha-benzoyl-DL-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
N-alpha-benzoyl-L-Arg-4-nitroanilide + H2O
N-alpha-benzoyl-L-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
N-alpha-benzyloxycarbonyl-L-lysine 4-nitrophenyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzoyl-Arg-p-nitroanilide + H2O
Nalpha-benzoyl-Arg + p-nitroaniline
show the reaction diagram
-
-
-
?
N-benzoyl-DL-arginine-2-naphthylamide + H2O
N-benzoyl-DL-arginine + 2-naphthylamine
show the reaction diagram
-
-
-
-
?
N-benzoyl-Gly ethyl ester + H2O
N-benzoyl-Gly + ethanol
show the reaction diagram
-
-
-
-
?
N-benzoyl-Gly methyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzoyl-Gly methyl ester + H2O
N-benzoyl-Gly + methanol
show the reaction diagram
-
-
-
-
?
N-benzoyl-Gly methyl thiono ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzoylglycinamide + H2O
Nalpha-benzoyl-Gly + NH3
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Ala methyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly 2-nitrophenyl ester + H2O
N-benzyloxycarbonyl-Gly + 2-nitrophenol
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly 3-nitrophenyl ester + H2O
N-benzyloxycarbonyl-Gly + 3-nitrophenol
show the reaction diagram
-
-
-
-
?
N-Benzyloxycarbonyl-Gly 4-nitrophenyl ester + H2O
N-Benzyloxycarbonyl-Gly + 4-nitrophenol
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly ethyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly phenyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly-Gly + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-Gly-p-nitroanilide + H2O
?
show the reaction diagram
-
-
-
?
N-benzyloxycarbonyl-L-Glu diamide + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-L-glycine + H2O
?
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-L-histidinamide + H2O
Nalpha-benzoyl-L-His + NH3
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-L-leucinamide + H2O
Nalpha-benzoyl-L-Leu + NH3
show the reaction diagram
-
-
-
-
?
N-benzyloxycarbonyl-L-Lys + H2O
?
show the reaction diagram
-
-
-
-
?
n-propyl 2-pyridyl disulfide + H2O
?
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-Arg-p-nitroanilide + H2O
Nalpha-benzoyl-Arg + p-nitroaniline
show the reaction diagram
-
-
-
?
Nalpha-benzoyl-DL-Arg-4-nitroanilide + H2O
Nalpha-benzoyl-DL-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
?
Nalpha-benzoyl-DL-arginine-4-nitroanilide + H2O
?
show the reaction diagram
-
-
-
?
Nalpha-benzoyl-DL-arginine-4-nitroanilide + H2O
Nalpha-benzoyl-DL-arginine + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-Gly methyl ester + H2O
Nalpha-benzoyl-Gly + methanol
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-L-Arg ethyl ester
?
show the reaction diagram
-
-
-
-
?
Nalpha-Benzoyl-L-Arg ethyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-L-argininamide + H2O
Nalpha-benzoyl-L-Arg + NH3
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-L-arginine ethyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-L-citrulline methyl ester + H2O
?
show the reaction diagram
-
-
-
-
?
Nalpha-benzoyl-L-lysinamide + H2O
Nalpha-benzoyl-L-Lys + NH3
show the reaction diagram
-
-
-
-
?
Nalpha-benzyloxycarbonyl-L-histidinamide + H2O
?
show the reaction diagram
-
-
-
-
?
ovalbumin + H2O
?
show the reaction diagram
-
-
-
-
?
oxidized beta-chain of insulin + H2O
?
show the reaction diagram
-
-
-
-
?
Phe-Arg-4-methylcoumaryl-7-amide + H2O
?
show the reaction diagram
-
-
-
?
phthalyl-Phe-Leu-p-nitroanilide + H2O
phthalyl-Phe-Leu + 4-nitroaniline
show the reaction diagram
-
-
-
?
rabbit IgG + H2O
?
show the reaction diagram
-
-
-
-
?
sarcoendoplasmic reticulum Ca2+-ATPase 1 + H2O
?
show the reaction diagram
-
-
-
-
?
sheep IgG + H2O
?
show the reaction diagram
-
-
-
-
?
succinyl-Phe-Leu-4-methylcoumaryl-7-amide + H2O
?
show the reaction diagram
-
-
-
?
succinyl-Phe-Leu-4-nitroanilide + H2O
succinyl-Phe-Leu + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
succinyl-Phe-Leu-p-nitroanilide + H2O
?
show the reaction diagram
-
-
-
?
succinyl-Phe-Leu-p-nitrophenol + H2O
?
show the reaction diagram
-
-
-
?
tarocystatin + H2O
?
show the reaction diagram
the C-terminal cystatin-like extension of tarocystatin is easily digested by papain
-
-
?
ubiquitin-7-amido-4-trifluoromethylcoumarin + H2O
?
show the reaction diagram
-
-
-
-
?
Z-Phe-Arg-4-nitroanilide + H2O
Z-Phe-Arg + 4-nitroaniline
show the reaction diagram
-
-
-
-
?
additional information
?
-